C23H30N4O6S — CID 69461005
2-[(4,5-diethoxy-2-hydroxyphenyl)methyl-piperidin-4-ylamino]-1,3-benzoxazole-5-sulfonamide (PubChem CID 69461005) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[(4,5-diethoxy-2-hydroxyphenyl)methyl-piperidin-4-ylamino]-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 2-[(4,5-diethoxy-2-hydroxyphenyl)methyl-piperidin-4-ylamino]-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 69461005 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[(4,5-diethoxy-2-hydroxyphenyl)methyl-piperidin-4-ylamino]-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCOc1cc(O)c(CN(c2nc3cc(S(N)(=O)=O)ccc3o2)C2CCNCC2)cc1OCC |
| InChI | InChI=1S/C23H30N4O6S/c1-3-31-21-11-15(19(28)13-22(21)32-4-2)14-27(16-7-9-25-10-8-16)23-26-18-12-17(34(24,29)30)5-6-20(18)33-23/h5-6,11-13,16,25,28H,3-4,7-10,14H2,1-2H3,(H2,24,29,30) |
| InChIKey | NGWXTYVUXAWNAW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|