C26H26N4O6 — CID 69461270
3-[7-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]-1,3-benzodioxol-4-yl]-N-(2-methoxyethyl)-N-methylprop-2-enamide (PubChem CID 69461270) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-[7-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]-1,3-benzodioxol-4-yl]-N-(2-methoxyethyl)-N-methylprop-2-enamide.
| Compound Name | 3-[7-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]-1,3-benzodioxol-4-yl]-N-(2-methoxyethyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 69461270 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-[7-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]-1,3-benzodioxol-4-yl]-N-(2-methoxyethyl)-N-methylprop-2-enamide |
| SMILES | COCCN(C)C(=O)C=Cc1ccc(Nc2c(C#N)cnc3cc(OC)c(OC)cc23)c2c1OCO2 |
| InChI | InChI=1S/C26H26N4O6/c1-30(9-10-32-2)23(31)8-6-16-5-7-19(26-25(16)35-15-36-26)29-24-17(13-27)14-28-20-12-22(34-4)21(33-3)11-18(20)24/h5-8,11-12,14H,9-10,15H2,1-4H3,(H,28,29) |
| InChIKey | GEHKGPWNWDZKKM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|