C22H33N3O5 — CID 69461339
tert-butyl (4S)-5-(benzamidocarbamoyl)-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 69461339) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl (4S)-5-(benzamidocarbamoyl)-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-5-(benzamidocarbamoyl)-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 69461339 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl (4S)-5-(benzamidocarbamoyl)-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)C[C@H]1C(C(=O)NNC(=O)c2ccccc2)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N3O5/c1-14(2)13-16-17(19(27)24-23-18(26)15-11-9-8-10-12-15)29-22(6,7)25(16)20(28)30-21(3,4)5/h8-12,14,16-17H,13H2,1-7H3,(H,23,26)(H,24,27)/t16-,17?/m0/s1 |
| InChIKey | SVWFULKUPFARPB-BHWOMJMDSA-N |
| XLogP | 3.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|