C12H13ClN3O+ — CID 6946164
3-(3-chlorophenyl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole (PubChem CID 6946164) has the molecular formula C12H13ClN3O+ and a molecular weight of 250.71 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-chlorophenyl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 6946164 |
| Molecular Formula | C12H13ClN3O+ |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-(3-chlorophenyl)-5-[(2S)-pyrrolidin-1-ium-2-yl]-1,2,4-oxadiazole |
| SMILES | Clc1cccc(-c2noc([C@@H]3CCC[NH2+]3)n2)c1 |
| InChI | InChI=1S/C12H12ClN3O/c13-9-4-1-3-8(7-9)11-15-12(17-16-11)10-5-2-6-14-10/h1,3-4,7,10,14H,2,5-6H2/p+1/t10-/m0/s1 |
| InChIKey | NPMYWCOYBYGCSM-JTQLQIEISA-O |
| XLogP | 1.79 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |