C26H30N6O — CID 69461654
(1S,2R,13S,14S,17R,18S)-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide (PubChem CID 69461654) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18S)-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide.
| Compound Name | (1S,2R,13S,14S,17R,18S)-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide |
|---|---|
| PubChem CID | 69461654 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (1S,2R,13S,14S,17R,18S)-N-(1H-imidazo[4,5-b]pyridin-2-ylmethyl)-6,9-diazapentacyclo[11.7.0.02,10.05,9.014,18]icosa-3,5,7-triene-17-carboxamide |
| SMILES | O=C(NCc1nc2ncccc2[nH]1)[C@@H]1CC[C@H]2[C@@H]3CCC4[C@H](C=Cc5nccn54)[C@H]3CC[C@@H]21 |
| InChI | InChI=1S/C26H30N6O/c33-26(29-14-23-30-21-2-1-11-28-25(21)31-23)20-6-5-15-16-7-9-22-19(17(16)3-4-18(15)20)8-10-24-27-12-13-32(22)24/h1-2,8,10-13,15-20,22H,3-7,9,14H2,(H,29,33)(H,28,30,31)/t15-,16-,17-,18-,19+,20+,22?/m0/s1 |
| InChIKey | FNJLLKBCWXWZLM-UVHCKLJTSA-N |
| XLogP | 4.12 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |