C26H30N2O3 — CID 69462356
5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 69462356) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69462356 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 5-[[4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C=C2NC(=O)NC2=O)cc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30N2O3/c1-15-11-19-20(26(4,5)10-9-25(19,2)3)14-17(15)18-12-16(7-8-22(18)31-6)13-21-23(29)28-24(30)27-21/h7-8,11-14H,9-10H2,1-6H3,(H2,27,28,29,30) |
| InChIKey | DVIRZBOYVSBOCA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|