About 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one
3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 69462376) has the molecular formula C28H30N2O3
and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 69462376 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)N(CC)C(=O)C(Cc1ccccc1)N=C2c1ccccc1 |
| InChI | InChI=1S/C28H30N2O3/c1-4-30-24-19-26(33-6-3)25(32-5-2)18-22(24)27(21-15-11-8-12-16-21)29-23(28(30)31)17-20-13-9-7-10-14-20/h7-16,18-19,23H,4-6,17H2,1-3H3 |
| InChIKey | FJLGAECREVUWAB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CID 69462376) is 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one is CCOc1cc2c(cc1OCC)N(CC)C(=O)C(Cc1ccccc1)N=C2c1ccccc1.
What is the InChIKey of 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is FJLGAECREVUWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O3/c1-4-30-24-19-26(33-6-3)25(32-5-2)18-22(24)27(21-15-11-8-12-16-21)29-23(28(30)31)17-20-13-9-7-10-14-20/h7-16,18-19,23H,4-6,17H2,1-3H3.
What are the key properties of 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 442.56 g/mol, XLogP of 5.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7,8-diethoxy-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 69462376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).