About 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine
4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine (PubChem CID 69462856) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine |
| PubChem CID | 69462856 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine |
| SMILES | CCNn1cc(N)c2occc21 |
| InChI | InChI=1S/C8H11N3O/c1-2-10-11-5-6(9)8-7(11)3-4-12-8/h3-5,10H,2,9H2,1H3 |
| InChIKey | BTTMCKRTZFRCJE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine?
The IUPAC name of 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine (CID 69462856) is 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine.
What is the SMILES notation for 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine?
The canonical SMILES for 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine is CCNn1cc(N)c2occc21.
What is the InChIKey of 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine?
The InChIKey is BTTMCKRTZFRCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-2-10-11-5-6(9)8-7(11)3-4-12-8/h3-5,10H,2,9H2,1H3.
What are the key properties of 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine?
4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine has a molecular weight of 165.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-ethylfuro[3,2-b]pyrrole-4,6-diamine is sourced from PubChem (CID 69462856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).