About 3-methylbenzoate
3-methylbenzoate (PubChem CID 6946312) has the molecular formula C8H7O2-
and a molecular weight of 135.14 g/mol. Its IUPAC name is 3-methylbenzoate.
Molecular Properties
| Compound Name | 3-methylbenzoate |
| PubChem CID | 6946312 |
| Molecular Formula | C8H7O2- |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | GPSDUZXPYCFOSQ-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzoate?
The IUPAC name of 3-methylbenzoate (CID 6946312) is 3-methylbenzoate.
What is the SMILES notation for 3-methylbenzoate?
The canonical SMILES for 3-methylbenzoate is Cc1cccc(C(=O)[O-])c1.
What is the InChIKey of 3-methylbenzoate?
The InChIKey is GPSDUZXPYCFOSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10)/p-1.
What are the key properties of 3-methylbenzoate?
3-methylbenzoate has a molecular weight of 135.14 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzoate is sourced from PubChem (CID 6946312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).