C16H28O4Si — CID 69463144
(3aS,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one (PubChem CID 69463144) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (3aS,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one.
| Compound Name | (3aS,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 69463144 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3aS,7R,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C=CC(=O)[C@H]2O1 |
| InChI | InChI=1S/C16H28O4Si/c1-15(2,3)21(6,7)18-10-11-8-9-12(17)14-13(11)19-16(4,5)20-14/h8-9,11,13-14H,10H2,1-7H3/t11-,13-,14-/m1/s1 |
| InChIKey | SNRPKJXMGIDFAM-MRVWCRGKSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|