C8H12N2S — CID 69463182
2,3,3a,4-tetrahydro-1-benzothiophene-2,6-diamine (PubChem CID 69463182) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1-benzothiophene-2,6-diamine.
| Compound Name | 2,3,3a,4-tetrahydro-1-benzothiophene-2,6-diamine |
|---|---|
| PubChem CID | 69463182 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1-benzothiophene-2,6-diamine |
| SMILES | NC1=CCC2CC(N)SC2=C1 |
| InChI | InChI=1S/C8H12N2S/c9-6-2-1-5-3-8(10)11-7(5)4-6/h2,4-5,8H,1,3,9-10H2 |
| InChIKey | FOTFESSZWOIEPI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |