C22H38O5 — CID 69463201
trans-(2R,3S)-3-[(4R)-4-methyloctyl]-2-(5,6,8-trihydroxy-7-oxooct-5-enyl)cyclopentan-1-one (PubChem CID 69463201) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is trans-(2R,3S)-3-[(4R)-4-methyloctyl]-2-(5,6,8-trihydroxy-7-oxooct-5-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3S)-3-[(4R)-4-methyloctyl]-2-(5,6,8-trihydroxy-7-oxooct-5-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 69463201 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | trans-(2R,3S)-3-[(4R)-4-methyloctyl]-2-(5,6,8-trihydroxy-7-oxooct-5-enyl)cyclopentan-1-one |
| SMILES | CCCC[C@@H](C)CCC[C@H]1CCC(=O)[C@@H]1CCCCC(O)=C(O)C(=O)CO |
| InChI | InChI=1S/C22H38O5/c1-3-4-8-16(2)9-7-10-17-13-14-19(24)18(17)11-5-6-12-20(25)22(27)21(26)15-23/h16-18,23,25,27H,3-15H2,1-2H3/t16-,17+,18-/m1/s1 |
| InChIKey | NNKINVHCJBARIJ-FGTMMUONSA-N |
| XLogP | 5.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|