About 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine
1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine (PubChem CID 69463464) has the molecular formula C5H7N5O
and a molecular weight of 153.15 g/mol. Its IUPAC name is 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine.
Molecular Properties
| Compound Name | 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine |
| PubChem CID | 69463464 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine |
| SMILES | COn1cnn2cnc(N)c12 |
| InChI | InChI=1S/C5H7N5O/c1-11-10-3-8-9-2-7-4(6)5(9)10/h2-3H,6H2,1H3 |
| InChIKey | AEOZQUAHQOXCDX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine?
The IUPAC name of 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine (CID 69463464) is 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine.
What is the SMILES notation for 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine?
The canonical SMILES for 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine is COn1cnn2cnc(N)c12.
What is the InChIKey of 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine?
The InChIKey is AEOZQUAHQOXCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5O/c1-11-10-3-8-9-2-7-4(6)5(9)10/h2-3H,6H2,1H3.
What are the key properties of 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine?
1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine has a molecular weight of 153.15 g/mol, XLogP of -0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyimidazo[1,5-b][1,2,4]triazol-7-amine is sourced from PubChem (CID 69463464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).