About 1,1-diphenylsilocane
1,1-diphenylsilocane (PubChem CID 69463623) has the molecular formula C19H24Si
and a molecular weight of 280.49 g/mol. Its IUPAC name is 1,1-diphenylsilocane.
Molecular Properties
| Compound Name | 1,1-diphenylsilocane |
| PubChem CID | 69463623 |
| Molecular Formula | C19H24Si |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1,1-diphenylsilocane |
| SMILES | c1ccc([Si]2(c3ccccc3)CCCCCCC2)cc1 |
| InChI | InChI=1S/C19H24Si/c1-2-10-16-20(17-11-3-1,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15H,1-3,10-11,16-17H2 |
| InChIKey | KPLBELNSTWVYHZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diphenylsilocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenylsilocane?
The IUPAC name of 1,1-diphenylsilocane (CID 69463623) is 1,1-diphenylsilocane.
What is the SMILES notation for 1,1-diphenylsilocane?
The canonical SMILES for 1,1-diphenylsilocane is c1ccc([Si]2(c3ccccc3)CCCCCCC2)cc1.
What is the InChIKey of 1,1-diphenylsilocane?
The InChIKey is KPLBELNSTWVYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Si/c1-2-10-16-20(17-11-3-1,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15H,1-3,10-11,16-17H2.
What are the key properties of 1,1-diphenylsilocane?
1,1-diphenylsilocane has a molecular weight of 280.49 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenylsilocane is sourced from PubChem (CID 69463623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).