About N,N-diethyl-3-methylbutanamide;1,3-thiazolidine
N,N-diethyl-3-methylbutanamide;1,3-thiazolidine (PubChem CID 69463759) has the molecular formula C12H26N2OS
and a molecular weight of 246.42 g/mol. Its IUPAC name is N,N-diethyl-3-methylbutanamide;1,3-thiazolidine.
Molecular Properties
| Compound Name | N,N-diethyl-3-methylbutanamide;1,3-thiazolidine |
| PubChem CID | 69463759 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N,N-diethyl-3-methylbutanamide;1,3-thiazolidine |
| SMILES | C1CSCN1.CCN(CC)C(=O)CC(C)C |
| InChI | InChI=1S/C9H19NO.C3H7NS/c1-5-10(6-2)9(11)7-8(3)4;1-2-5-3-4-1/h8H,5-7H2,1-4H3;4H,1-3H2 |
| InChIKey | ZKCRUHRZQZBWHV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-3-methylbutanamide;1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-methylbutanamide;1,3-thiazolidine?
The IUPAC name of N,N-diethyl-3-methylbutanamide;1,3-thiazolidine (CID 69463759) is N,N-diethyl-3-methylbutanamide;1,3-thiazolidine.
What is the SMILES notation for N,N-diethyl-3-methylbutanamide;1,3-thiazolidine?
The canonical SMILES for N,N-diethyl-3-methylbutanamide;1,3-thiazolidine is C1CSCN1.CCN(CC)C(=O)CC(C)C.
What is the InChIKey of N,N-diethyl-3-methylbutanamide;1,3-thiazolidine?
The InChIKey is ZKCRUHRZQZBWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C3H7NS/c1-5-10(6-2)9(11)7-8(3)4;1-2-5-3-4-1/h8H,5-7H2,1-4H3;4H,1-3H2.
What are the key properties of N,N-diethyl-3-methylbutanamide;1,3-thiazolidine?
N,N-diethyl-3-methylbutanamide;1,3-thiazolidine has a molecular weight of 246.42 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-methylbutanamide;1,3-thiazolidine is sourced from PubChem (CID 69463759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).