About (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate
(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate (PubChem CID 69463844) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate.
Molecular Properties
| Compound Name | (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate |
| PubChem CID | 69463844 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)O)cc1.O |
| InChI | InChI=1S/C12H15NO4S.H2O/c1-9-4-6-10(7-5-9)18(16,17)13-8-2-3-11(13)12(14)15;/h4-7,11H,2-3,8H2,1H3,(H,14,15);1H2/t11-;/m0./s1 |
| InChIKey | HQJWDHYFSJMNPB-MERQFXBCSA-N |
| XLogP | 0.41 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate?
The IUPAC name of (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate (CID 69463844) is (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate.
What is the SMILES notation for (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate?
The canonical SMILES for (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate is Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)O)cc1.O.
What is the InChIKey of (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate?
The InChIKey is HQJWDHYFSJMNPB-MERQFXBCSA-N. The full InChI is InChI=1S/C12H15NO4S.H2O/c1-9-4-6-10(7-5-9)18(16,17)13-8-2-3-11(13)12(14)15;/h4-7,11H,2-3,8H2,1H3,(H,14,15);1H2/t11-;/m0./s1.
What are the key properties of (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate?
(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate has a molecular weight of 287.34 g/mol, XLogP of 0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid;hydrate is sourced from PubChem (CID 69463844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).