C21H27BrF2NO5P — CID 69463943
[[2-bromo-4-[(2S)-2-[(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)amino]-3-oxobutyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 69463943) has the molecular formula C21H27BrF2NO5P and a molecular weight of 522.32 g/mol. Its IUPAC name is [[2-bromo-4-[(2S)-2-[(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)amino]-3-oxobutyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(2S)-2-[(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)amino]-3-oxobutyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 69463943 |
| Molecular Formula | C21H27BrF2NO5P |
| Molecular Weight | 522.32 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | [[2-bromo-4-[(2S)-2-[(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)amino]-3-oxobutyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CC(=O)[C@H](Cc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1)/N=C1\CC2CC(C1(C)O)C2(C)C |
| InChI | InChI=1S/C21H27BrF2NO5P/c1-11(26)16(25-18-10-13-9-17(19(13,2)3)20(18,4)27)8-12-5-6-14(15(22)7-12)21(23,24)31(28,29)30/h5-7,13,16-17,27H,8-10H2,1-4H3,(H2,28,29,30)/b25-18+/t13?,16-,17?,20?/m0/s1 |
| InChIKey | IYJDAJJMMWMMOK-NURBUQEDSA-N |
| XLogP | 4.43 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|