About 3-bromopyridine;pyridin-3-ylboronic acid
3-bromopyridine;pyridin-3-ylboronic acid (PubChem CID 69464448) has the molecular formula C10H10BBrN2O2
and a molecular weight of 280.92 g/mol. Its IUPAC name is 3-bromopyridine;pyridin-3-ylboronic acid.
Molecular Properties
| Compound Name | 3-bromopyridine;pyridin-3-ylboronic acid |
| PubChem CID | 69464448 |
| Molecular Formula | C10H10BBrN2O2 |
| Molecular Weight | 280.92 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 3-bromopyridine;pyridin-3-ylboronic acid |
| SMILES | Brc1cccnc1.OB(O)c1cccnc1 |
| InChI | InChI=1S/C5H6BNO2.C5H4BrN/c8-6(9)5-2-1-3-7-4-5;6-5-2-1-3-7-4-5/h1-4,8-9H;1-4H |
| InChIKey | ZXTWXPIRDFOVCE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.92 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopyridine;pyridin-3-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine;pyridin-3-ylboronic acid?
The IUPAC name of 3-bromopyridine;pyridin-3-ylboronic acid (CID 69464448) is 3-bromopyridine;pyridin-3-ylboronic acid.
What is the SMILES notation for 3-bromopyridine;pyridin-3-ylboronic acid?
The canonical SMILES for 3-bromopyridine;pyridin-3-ylboronic acid is Brc1cccnc1.OB(O)c1cccnc1.
What is the InChIKey of 3-bromopyridine;pyridin-3-ylboronic acid?
The InChIKey is ZXTWXPIRDFOVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BNO2.C5H4BrN/c8-6(9)5-2-1-3-7-4-5;6-5-2-1-3-7-4-5/h1-4,8-9H;1-4H.
What are the key properties of 3-bromopyridine;pyridin-3-ylboronic acid?
3-bromopyridine;pyridin-3-ylboronic acid has a molecular weight of 280.92 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine;pyridin-3-ylboronic acid is sourced from PubChem (CID 69464448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).