C16H28N2O2+2 — CID 6946481
2',2',5,7-tetramethylspiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,4'-oxane]-6-one (PubChem CID 6946481) has the molecular formula C16H28N2O2+2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2',2',5,7-tetramethylspiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,4'-oxane]-6-one.
| Compound Name | 2',2',5,7-tetramethylspiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,4'-oxane]-6-one |
|---|---|
| PubChem CID | 6946481 |
| Molecular Formula | C16H28N2O2+2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 2',2',5,7-tetramethylspiro[1,3-diazoniatricyclo[3.3.1.13,7]decane-2,4'-oxane]-6-one |
| SMILES | CC1(C)CC2(CCO1)[NH+]1CC3(C)C[NH+]2CC(C)(C1)C3=O |
| InChI | InChI=1S/C16H26N2O2/c1-13(2)7-16(5-6-20-13)17-8-14(3)9-18(16)11-15(4,10-17)12(14)19/h5-11H2,1-4H3/p+2 |
| InChIKey | WQRVDNZVISFEBP-UHFFFAOYSA-P |
| XLogP | -1.34 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |