C21H28N8O3 — CID 69464932
N'-(2-cyano-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbohydrazide (PubChem CID 69464932) has the molecular formula C21H28N8O3 and a molecular weight of 440.51 g/mol. Its IUPAC name is N'-(2-cyano-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbohydrazide.
| Compound Name | N'-(2-cyano-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbohydrazide |
|---|---|
| PubChem CID | 69464932 |
| Molecular Formula | C21H28N8O3 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N'-(2-cyano-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carbohydrazide |
| SMILES | CC(C)(C)CN(NC(=O)N1CCC2(CC1)NC(=O)NC2=O)c1nc(C#N)nc2c1CCC2 |
| InChI | InChI=1S/C21H28N8O3/c1-20(2,3)12-29(16-13-5-4-6-14(13)23-15(11-22)24-16)27-19(32)28-9-7-21(8-10-28)17(30)25-18(31)26-21/h4-10,12H2,1-3H3,(H,27,32)(H2,25,26,30,31) |
| InChIKey | RFMMYGWIPXNIKW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|