C31H33ClN2O5 — CID 69465116
ethyl 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-1,2,3,4-tetrahydroquinoline-3-carbonyl]phenoxy]butanoate (PubChem CID 69465116) has the molecular formula C31H33ClN2O5 and a molecular weight of 549.07 g/mol. Its IUPAC name is ethyl 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-1,2,3,4-tetrahydroquinoline-3-carbonyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-1,2,3,4-tetrahydroquinoline-3-carbonyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 69465116 |
| Molecular Formula | C31H33ClN2O5 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | ethyl 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-1,2,3,4-tetrahydroquinoline-3-carbonyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(C(=O)C2[C@H](C)Nc3ccccc3[C@@H]2N(C(C)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33ClN2O5/c1-4-38-28(36)10-7-19-39-25-17-11-22(12-18-25)31(37)29-20(2)33-27-9-6-5-8-26(27)30(29)34(21(3)35)24-15-13-23(32)14-16-24/h5-6,8-9,11-18,20,29-30,33H,4,7,10,19H2,1-3H3/t20-,29?,30-/m0/s1 |
| InChIKey | ILIKEFFHOWXFPH-TURJVXBYSA-N |
| XLogP | 6.47 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|