C25H27FO2 — CID 69465472
(7S,8R,9R,10R,13S,14S)-7-fluoro-13-methyl-3-phenylmethoxy-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthren-17-one (PubChem CID 69465472) has the molecular formula C25H27FO2 and a molecular weight of 378.49 g/mol. Its IUPAC name is (7S,8R,9R,10R,13S,14S)-7-fluoro-13-methyl-3-phenylmethoxy-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (7S,8R,9R,10R,13S,14S)-7-fluoro-13-methyl-3-phenylmethoxy-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 69465472 |
| Molecular Formula | C25H27FO2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (7S,8R,9R,10R,13S,14S)-7-fluoro-13-methyl-3-phenylmethoxy-8,9,10,11,12,14,15,16-octahydro-7H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](F)C=C4C=C(OCc5ccccc5)C=C[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H27FO2/c1-25-12-11-20-19-8-7-18(28-15-16-5-3-2-4-6-16)13-17(19)14-22(26)24(20)21(25)9-10-23(25)27/h2-8,13-14,19-22,24H,9-12,15H2,1H3/t19-,20+,21-,22+,24+,25-/m0/s1 |
| InChIKey | UVAJCGLTGBTQTC-NUCMZNAFSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |