C12H17N5O3 — CID 694655
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-propan-2-ylacetamide (PubChem CID 694655) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 694655 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H17N5O3/c1-7(2)14-8(18)5-17-6-13-10-9(17)11(19)16(4)12(20)15(10)3/h6-7H,5H2,1-4H3,(H,14,18) |
| InChIKey | LBEHGLCKLIRAHI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |