About 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine
1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine (PubChem CID 69465678) has the molecular formula C22H44N4
and a molecular weight of 364.62 g/mol. Its IUPAC name is 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine |
| PubChem CID | 69465678 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(CCCN2CCN(CCN3CC(C)CC(C)C3)C2)C1 |
| InChI | InChI=1S/C22H44N4/c1-19-12-20(2)15-25(14-19)7-5-6-23-8-9-24(18-23)10-11-26-16-21(3)13-22(4)17-26/h19-22H,5-18H2,1-4H3 |
| InChIKey | NPAHUMCNZBLVQO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine?
The IUPAC name of 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine (CID 69465678) is 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine.
What is the SMILES notation for 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine?
The canonical SMILES for 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine is CC1CC(C)CN(CCCN2CCN(CCN3CC(C)CC(C)C3)C2)C1.
What is the InChIKey of 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine?
The InChIKey is NPAHUMCNZBLVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44N4/c1-19-12-20(2)15-25(14-19)7-5-6-23-8-9-24(18-23)10-11-26-16-21(3)13-22(4)17-26/h19-22H,5-18H2,1-4H3.
What are the key properties of 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine?
1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine has a molecular weight of 364.62 g/mol, XLogP of 2.91, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[3-[2-(3,5-dimethylpiperidin-1-yl)ethyl]imidazolidin-1-yl]propyl]-3,5-dimethylpiperidine is sourced from PubChem (CID 69465678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).