C24H25FO2 — CID 69465751
(7S,8R,9R,10R,13S,14R)-7-fluoro-3-phenylmethoxy-7,8,9,10,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 69465751) has the molecular formula C24H25FO2 and a molecular weight of 364.46 g/mol. Its IUPAC name is (7S,8R,9R,10R,13S,14R)-7-fluoro-3-phenylmethoxy-7,8,9,10,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (7S,8R,9R,10R,13S,14R)-7-fluoro-3-phenylmethoxy-7,8,9,10,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 69465751 |
| Molecular Formula | C24H25FO2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (7S,8R,9R,10R,13S,14R)-7-fluoro-3-phenylmethoxy-7,8,9,10,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | O=C1CC[C@H]2[C@H]3[C@H](CC[C@H]12)[C@H]1C=CC(OCc2ccccc2)=CC1=C[C@H]3F |
| InChI | InChI=1S/C24H25FO2/c25-22-13-16-12-17(27-14-15-4-2-1-3-5-15)6-7-18(16)20-9-8-19-21(24(20)22)10-11-23(19)26/h1-7,12-13,18-22,24H,8-11,14H2/t18-,19-,20+,21+,22+,24+/m0/s1 |
| InChIKey | ASJGMJRBSBUTDL-ACWSOFASSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |