C21H19NO4 — CID 69466497
4,5-diphenyl-1-propan-2-ylpyrrole-2,3-dicarboxylic acid (PubChem CID 69466497) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4,5-diphenyl-1-propan-2-ylpyrrole-2,3-dicarboxylic acid.
| Compound Name | 4,5-diphenyl-1-propan-2-ylpyrrole-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 69466497 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4,5-diphenyl-1-propan-2-ylpyrrole-2,3-dicarboxylic acid |
| SMILES | CC(C)n1c(C(=O)O)c(C(=O)O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H19NO4/c1-13(2)22-18(15-11-7-4-8-12-15)16(14-9-5-3-6-10-14)17(20(23)24)19(22)21(25)26/h3-13H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | YYDXJPDZIGHFMW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |