C13H14N2O — CID 69466527
5,6a,7,10,10a,11-hexahydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69466527) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 5,6a,7,10,10a,11-hexahydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5,6a,7,10,10a,11-hexahydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69466527 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5,6a,7,10,10a,11-hexahydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccccc2NC2CC=CCC12 |
| InChI | InChI=1S/C13H14N2O/c16-13-9-5-1-2-6-10(9)14-11-7-3-4-8-12(11)15-13/h1-4,7-10,14H,5-6H2,(H,15,16) |
| InChIKey | BJPQWPNYVDVYFB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|