About 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid
6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid (PubChem CID 69467144) has the molecular formula C29H36O4
and a molecular weight of 448.60 g/mol. Its IUPAC name is 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid |
| PubChem CID | 69467144 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid |
| SMILES | CCC(CCc1ccc(OCC(O)C(C)(C)C)c(C)c1)c1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C29H36O4/c1-6-21(22-10-11-24-17-25(28(31)32)13-12-23(24)16-22)9-7-20-8-14-26(19(2)15-20)33-18-27(30)29(3,4)5/h8,10-17,21,27,30H,6-7,9,18H2,1-5H3,(H,31,32) |
| InChIKey | CIOBBANXMUXELB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid?
The IUPAC name of 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid (CID 69467144) is 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid.
What is the SMILES notation for 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid?
The canonical SMILES for 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid is CCC(CCc1ccc(OCC(O)C(C)(C)C)c(C)c1)c1ccc2cc(C(=O)O)ccc2c1.
What is the InChIKey of 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid?
The InChIKey is CIOBBANXMUXELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H36O4/c1-6-21(22-10-11-24-17-25(28(31)32)13-12-23(24)16-22)9-7-20-8-14-26(19(2)15-20)33-18-27(30)29(3,4)5/h8,10-17,21,27,30H,6-7,9,18H2,1-5H3,(H,31,32).
What are the key properties of 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid?
6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid has a molecular weight of 448.60 g/mol, XLogP of 6.76, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]naphthalene-2-carboxylic acid is sourced from PubChem (CID 69467144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).