C26H27N2O3+ — CID 69467327
N-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3-methyl-4-phenylisoquinolin-2-ium-2-amine (PubChem CID 69467327) has the molecular formula C26H27N2O3+ and a molecular weight of 415.51 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3-methyl-4-phenylisoquinolin-2-ium-2-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3-methyl-4-phenylisoquinolin-2-ium-2-amine |
|---|---|
| PubChem CID | 69467327 |
| Molecular Formula | C26H27N2O3+ |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3-methyl-4-phenylisoquinolin-2-ium-2-amine |
| SMILES | COc1ccc2c[n+](NCc3ccc(OC)c(OC)c3)c(C)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H27N2O3/c1-18-26(20-8-6-5-7-9-20)23-15-22(29-2)12-11-21(23)17-28(18)27-16-19-10-13-24(30-3)25(14-19)31-4/h5-15,17,27H,16H2,1-4H3/q+1 |
| InChIKey | PHZKBGNAEJOZBI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|