C19H29NO2S — CID 69467556
butyl 2-[[2-(ethylamino)-2,3-dihydro-1H-inden-5-yl]sulfanyl]-2-methylpropanoate (PubChem CID 69467556) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is butyl 2-[[2-(ethylamino)-2,3-dihydro-1H-inden-5-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | butyl 2-[[2-(ethylamino)-2,3-dihydro-1H-inden-5-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 69467556 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | butyl 2-[[2-(ethylamino)-2,3-dihydro-1H-inden-5-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Sc1ccc2c(c1)CC(NCC)C2 |
| InChI | InChI=1S/C19H29NO2S/c1-5-7-10-22-18(21)19(3,4)23-17-9-8-14-11-16(20-6-2)12-15(14)13-17/h8-9,13,16,20H,5-7,10-12H2,1-4H3 |
| InChIKey | DUUDIKAKGSDEIV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|