About 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile
23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile (PubChem CID 69467576) has the molecular formula C22H14N6
and a molecular weight of 362.40 g/mol. Its IUPAC name is 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile.
Molecular Properties
| Compound Name | 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile |
| PubChem CID | 69467576 |
| Molecular Formula | C22H14N6 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile |
| SMILES | N#CC1c2ccc([nH]2)C=c2ccc([nH]2)=CC2=NC(=CC3=NC1(C#N)C=C3)C=C2 |
| InChI | InChI=1S/C22H14N6/c23-12-20-21-6-5-18(27-21)10-16-2-1-14(25-16)9-15-3-4-17(26-15)11-19-7-8-22(20,13-24)28-19/h1-11,20,25,27H |
| InChIKey | PGIOIQCPGRNNLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile?
The IUPAC name of 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile (CID 69467576) is 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile.
What is the SMILES notation for 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile?
The canonical SMILES for 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile is N#CC1c2ccc([nH]2)C=c2ccc([nH]2)=CC2=NC(=CC3=NC1(C#N)C=C3)C=C2.
What is the InChIKey of 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile?
The InChIKey is PGIOIQCPGRNNLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N6/c23-12-20-21-6-5-18(27-21)10-16-2-1-14(25-16)9-15-3-4-17(26-15)11-19-7-8-22(20,13-24)28-19/h1-11,20,25,27H.
What are the key properties of 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile?
23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile has a molecular weight of 362.40 g/mol, XLogP of 1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 23,24-dihydro-20H-porphyrin-1,20-dicarbonitrile is sourced from PubChem (CID 69467576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).