C37H40N4O3S — CID 69467716
2-[2-[3-(N-(2,2-diphenylacetyl)-4-piperidin-1-ylanilino)propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid (PubChem CID 69467716) has the molecular formula C37H40N4O3S and a molecular weight of 620.82 g/mol. Its IUPAC name is 2-[2-[3-(N-(2,2-diphenylacetyl)-4-piperidin-1-ylanilino)propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid.
| Compound Name | 2-[2-[3-(N-(2,2-diphenylacetyl)-4-piperidin-1-ylanilino)propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 69467716 |
| Molecular Formula | C37H40N4O3S |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | 2-[2-[3-(N-(2,2-diphenylacetyl)-4-piperidin-1-ylanilino)propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid |
| SMILES | O=C(O)CC1(SCCCN(C(=O)C(c2ccccc2)c2ccccc2)c2ccc(N3CCCCC3)cc2)Nc2ccccc2N1 |
| InChI | InChI=1S/C37H40N4O3S/c42-34(43)27-37(38-32-17-8-9-18-33(32)39-37)45-26-12-25-41(31-21-19-30(20-22-31)40-23-10-3-11-24-40)36(44)35(28-13-4-1-5-14-28)29-15-6-2-7-16-29/h1-2,4-9,13-22,35,38-39H,3,10-12,23-27H2,(H,42,43) |
| InChIKey | HXZOKSHSBXLKOJ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|