C19H30BNO3 — CID 69468260
2,2,4,8-tetramethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-3-ol (PubChem CID 69468260) has the molecular formula C19H30BNO3 and a molecular weight of 331.27 g/mol. Its IUPAC name is 2,2,4,8-tetramethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-3-ol.
| Compound Name | 2,2,4,8-tetramethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-3-ol |
|---|---|
| PubChem CID | 69468260 |
| Molecular Formula | C19H30BNO3 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2,2,4,8-tetramethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-quinolin-3-ol |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1NC(C)(C)C(O)C2C |
| InChI | InChI=1S/C19H30BNO3/c1-11-9-13(20-23-18(5,6)19(7,8)24-20)10-14-12(2)16(22)17(3,4)21-15(11)14/h9-10,12,16,21-22H,1-8H3 |
| InChIKey | SVASVNFFIKQKKV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|