About 4-nitro-3-oxo-1,2-dihydroinden-5-olate
4-nitro-3-oxo-1,2-dihydroinden-5-olate (PubChem CID 6946836) has the molecular formula C9H6NO4-
and a molecular weight of 192.15 g/mol. Its IUPAC name is 4-nitro-3-oxo-1,2-dihydroinden-5-olate.
Molecular Properties
| Compound Name | 4-nitro-3-oxo-1,2-dihydroinden-5-olate |
| PubChem CID | 6946836 |
| Molecular Formula | C9H6NO4- |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 4-nitro-3-oxo-1,2-dihydroinden-5-olate |
| SMILES | O=C1CCc2ccc([O-])c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H7NO4/c11-6-3-1-5-2-4-7(12)9(8(5)6)10(13)14/h2,4,12H,1,3H2/p-1 |
| InChIKey | OMSIDHRDOFJRKC-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3-oxo-1,2-dihydroinden-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3-oxo-1,2-dihydroinden-5-olate?
The IUPAC name of 4-nitro-3-oxo-1,2-dihydroinden-5-olate (CID 6946836) is 4-nitro-3-oxo-1,2-dihydroinden-5-olate.
What is the SMILES notation for 4-nitro-3-oxo-1,2-dihydroinden-5-olate?
The canonical SMILES for 4-nitro-3-oxo-1,2-dihydroinden-5-olate is O=C1CCc2ccc([O-])c([N+](=O)[O-])c21.
What is the InChIKey of 4-nitro-3-oxo-1,2-dihydroinden-5-olate?
The InChIKey is OMSIDHRDOFJRKC-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NO4/c11-6-3-1-5-2-4-7(12)9(8(5)6)10(13)14/h2,4,12H,1,3H2/p-1.
What are the key properties of 4-nitro-3-oxo-1,2-dihydroinden-5-olate?
4-nitro-3-oxo-1,2-dihydroinden-5-olate has a molecular weight of 192.15 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3-oxo-1,2-dihydroinden-5-olate is sourced from PubChem (CID 6946836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).