C15H14NO6- — CID 6946883
4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]methyl]benzoate (PubChem CID 6946883) has the molecular formula C15H14NO6- and a molecular weight of 304.28 g/mol. Its IUPAC name is 4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]methyl]benzoate.
| Compound Name | 4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]methyl]benzoate |
|---|---|
| PubChem CID | 6946883 |
| Molecular Formula | C15H14NO6- |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]methyl]benzoate |
| SMILES | CC1(C)OC(=O)C(/C=N/Cc2ccc(C(=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C15H15NO6/c1-15(2)21-13(19)11(14(20)22-15)8-16-7-9-3-5-10(6-4-9)12(17)18/h3-6,8,11H,7H2,1-2H3,(H,17,18)/p-1/b16-8+ |
| InChIKey | ZJNYFTAKVPCTGS-LZYBPNLTSA-M |
| XLogP | 0.07 |
| TPSA | 105.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|