About 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde
2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde (PubChem CID 6946907) has the molecular formula C12H16N3O2+
and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde |
| PubChem CID | 6946907 |
| Molecular Formula | C12H16N3O2+ |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde |
| SMILES | Nc1[nH+]c(N2CCCCC2)c(C=O)cc1C=O |
| InChI | InChI=1S/C12H15N3O2/c13-11-9(7-16)6-10(8-17)12(14-11)15-4-2-1-3-5-15/h6-8H,1-5H2,(H2,13,14)/p+1 |
| InChIKey | GHIPSQDBTRMEHF-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde?
The IUPAC name of 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde (CID 6946907) is 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde.
What is the SMILES notation for 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde?
The canonical SMILES for 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde is Nc1[nH+]c(N2CCCCC2)c(C=O)cc1C=O.
What is the InChIKey of 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde?
The InChIKey is GHIPSQDBTRMEHF-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H15N3O2/c13-11-9(7-16)6-10(8-17)12(14-11)15-4-2-1-3-5-15/h6-8H,1-5H2,(H2,13,14)/p+1.
What are the key properties of 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde?
2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde has a molecular weight of 234.28 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-piperidin-1-ylpyridin-1-ium-3,5-dicarbaldehyde is sourced from PubChem (CID 6946907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).