C13H9NO4S — CID 6946915
(4S)-2-(1,3-dioxoinden-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 6946915) has the molecular formula C13H9NO4S and a molecular weight of 275.28 g/mol. Its IUPAC name is (4S)-2-(1,3-dioxoinden-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | (4S)-2-(1,3-dioxoinden-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 6946915 |
| Molecular Formula | C13H9NO4S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (4S)-2-(1,3-dioxoinden-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C1c2ccccc2C(=O)C1C1=N[C@@H](C(=O)O)CS1 |
| InChI | InChI=1S/C13H9NO4S/c15-10-6-3-1-2-4-7(6)11(16)9(10)12-14-8(5-19-12)13(17)18/h1-4,8-9H,5H2,(H,17,18)/t8-/m1/s1 |
| InChIKey | QGMFZWXKEVSLAR-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|