About 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide
2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (PubChem CID 69469624) has the molecular formula C16H29F2N3O
and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| PubChem CID | 69469624 |
| Molecular Formula | C16H29F2N3O |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CNCC(CC1CCC(F)(F)CC1)C1CCCCN1C(N)=O |
| InChI | InChI=1S/C16H29F2N3O/c1-20-11-13(10-12-5-7-16(17,18)8-6-12)14-4-2-3-9-21(14)15(19)22/h12-14,20H,2-11H2,1H3,(H2,19,22) |
| InChIKey | WMFROTZPRMOXHC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide?
The IUPAC name of 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide (CID 69469624) is 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide.
What is the SMILES notation for 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide?
The canonical SMILES for 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide is CNCC(CC1CCC(F)(F)CC1)C1CCCCN1C(N)=O.
What is the InChIKey of 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide?
The InChIKey is WMFROTZPRMOXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29F2N3O/c1-20-11-13(10-12-5-7-16(17,18)8-6-12)14-4-2-3-9-21(14)15(19)22/h12-14,20H,2-11H2,1H3,(H2,19,22).
What are the key properties of 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide?
2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide has a molecular weight of 317.42 g/mol, XLogP of 2.97, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,4-difluorocyclohexyl)-3-(methylamino)propan-2-yl]piperidine-1-carboxamide is sourced from PubChem (CID 69469624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).