C14H19BrClN3 — CID 69469798
(10R,15S)-7-bromo-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene;hydrochloride (PubChem CID 69469798) has the molecular formula C14H19BrClN3 and a molecular weight of 344.68 g/mol. Its IUPAC name is (10R,15S)-7-bromo-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene;hydrochloride.
| Compound Name | (10R,15S)-7-bromo-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene;hydrochloride |
|---|---|
| PubChem CID | 69469798 |
| Molecular Formula | C14H19BrClN3 |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (10R,15S)-7-bromo-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene;hydrochloride |
| SMILES | CN1CCN2c3c(cc(Br)cc31)[C@@H]1CNCC[C@@H]12.Cl |
| InChI | InChI=1S/C14H18BrN3.ClH/c1-17-4-5-18-12-2-3-16-8-11(12)10-6-9(15)7-13(17)14(10)18;/h6-7,11-12,16H,2-5,8H2,1H3;1H/t11-,12-;/m0./s1 |
| InChIKey | HEZUEXIDTVSVKS-FXMYHANSSA-N |
| XLogP | 2.59 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |