About 2-nitrophenol
2-nitrophenol (PubChem CID 6947) has the molecular formula C6H5NO3
and a molecular weight of 139.11 g/mol. Its IUPAC name is 2-nitrophenol.
Molecular Properties
| Compound Name | 2-nitrophenol |
| PubChem CID | 6947 |
| Molecular Formula | C6H5NO3 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 2-nitrophenol |
| SMILES | O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H |
| InChIKey | IQUPABOKLQSFBK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrophenol?
The IUPAC name of 2-nitrophenol (CID 6947) is 2-nitrophenol.
What is the SMILES notation for 2-nitrophenol?
The canonical SMILES for 2-nitrophenol is O=[N+]([O-])c1ccccc1O.
What is the InChIKey of 2-nitrophenol?
The InChIKey is IQUPABOKLQSFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H.
What are the key properties of 2-nitrophenol?
2-nitrophenol has a molecular weight of 139.11 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrophenol is sourced from PubChem (CID 6947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).