About 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride
5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride (PubChem CID 69470000) has the molecular formula C6H8ClN3OS
and a molecular weight of 205.67 g/mol. Its IUPAC name is 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride |
| PubChem CID | 69470000 |
| Molecular Formula | C6H8ClN3OS |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1nnc(C2CC2)s1 |
| InChI | InChI=1S/C6H7N3OS.ClH/c7-4(10)6-9-8-5(11-6)3-1-2-3;/h3H,1-2H2,(H2,7,10);1H |
| InChIKey | YKNWDGQJEANIBX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride?
The IUPAC name of 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride (CID 69470000) is 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride.
What is the SMILES notation for 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride?
The canonical SMILES for 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride is Cl.NC(=O)c1nnc(C2CC2)s1.
What is the InChIKey of 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride?
The InChIKey is YKNWDGQJEANIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3OS.ClH/c7-4(10)6-9-8-5(11-6)3-1-2-3;/h3H,1-2H2,(H2,7,10);1H.
What are the key properties of 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride?
5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride has a molecular weight of 205.67 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1,3,4-thiadiazole-2-carboxamide;hydrochloride is sourced from PubChem (CID 69470000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).