About 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide
2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 69470153) has the molecular formula C21H17N3O3S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide |
| PubChem CID | 69470153 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1Cc1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C21H17N3O3S/c22-28(25,26)19-9-5-4-8-18(19)14-15-10-12-17(13-11-15)21-24-23-20(27-21)16-6-2-1-3-7-16/h1-13H,14H2,(H2,22,25,26) |
| InChIKey | QPGDTJDGYMLOLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide?
The IUPAC name of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide (CID 69470153) is 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide.
What is the SMILES notation for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide?
The canonical SMILES for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide is NS(=O)(=O)c1ccccc1Cc1ccc(-c2nnc(-c3ccccc3)o2)cc1.
What is the InChIKey of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide?
The InChIKey is QPGDTJDGYMLOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O3S/c22-28(25,26)19-9-5-4-8-18(19)14-15-10-12-17(13-11-15)21-24-23-20(27-21)16-6-2-1-3-7-16/h1-13H,14H2,(H2,22,25,26).
What are the key properties of 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide?
2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide has a molecular weight of 391.45 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methyl]benzenesulfonamide is sourced from PubChem (CID 69470153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).