C17H16F3NO — CID 69470451
1-benzyl-7-(trifluoromethyl)-2,3,4a,8a-tetrahydroquinolin-4-one (PubChem CID 69470451) has the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-benzyl-7-(trifluoromethyl)-2,3,4a,8a-tetrahydroquinolin-4-one.
| Compound Name | 1-benzyl-7-(trifluoromethyl)-2,3,4a,8a-tetrahydroquinolin-4-one |
|---|---|
| PubChem CID | 69470451 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-benzyl-7-(trifluoromethyl)-2,3,4a,8a-tetrahydroquinolin-4-one |
| SMILES | O=C1CCN(Cc2ccccc2)C2C=C(C(F)(F)F)C=CC12 |
| InChI | InChI=1S/C17H16F3NO/c18-17(19,20)13-6-7-14-15(10-13)21(9-8-16(14)22)11-12-4-2-1-3-5-12/h1-7,10,14-15H,8-9,11H2 |
| InChIKey | PCDOKWQLGLICPM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |