C14H29N2O2+ — CID 69470766
1-[4-(2-hydroxyethyl)-4-methylpiperazin-4-ium-1-yl]-2,2,3-trimethylbutan-1-one (PubChem CID 69470766) has the molecular formula C14H29N2O2+ and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)-4-methylpiperazin-4-ium-1-yl]-2,2,3-trimethylbutan-1-one.
| Compound Name | 1-[4-(2-hydroxyethyl)-4-methylpiperazin-4-ium-1-yl]-2,2,3-trimethylbutan-1-one |
|---|---|
| PubChem CID | 69470766 |
| Molecular Formula | C14H29N2O2+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)-4-methylpiperazin-4-ium-1-yl]-2,2,3-trimethylbutan-1-one |
| SMILES | CC(C)C(C)(C)C(=O)N1CC[N+](C)(CCO)CC1 |
| InChI | InChI=1S/C14H29N2O2/c1-12(2)14(3,4)13(18)15-6-8-16(5,9-7-15)10-11-17/h12,17H,6-11H2,1-5H3/q+1 |
| InChIKey | DFNBSLVWQZNEPY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|