C14H17N3O2 — CID 69471166
(10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylic acid (PubChem CID 69471166) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylic acid.
| Compound Name | (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylic acid |
|---|---|
| PubChem CID | 69471166 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylic acid |
| SMILES | O=C(O)N1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3 |
| InChI | InChI=1S/C14H17N3O2/c18-14(19)16-6-4-12-10(8-16)9-2-1-3-11-13(9)17(12)7-5-15-11/h1-3,10,12,15H,4-8H2,(H,18,19)/t10-,12-/m0/s1 |
| InChIKey | YBVQUEDJEOAEFT-JQWIXIFHSA-N |
| XLogP | 1.77 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |