C20H31ClN2O4S — CID 69471206
4-chloro-N-(8-hydroxyoctyl)-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide (PubChem CID 69471206) has the molecular formula C20H31ClN2O4S and a molecular weight of 431.00 g/mol. Its IUPAC name is 4-chloro-N-(8-hydroxyoctyl)-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(8-hydroxyoctyl)-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 69471206 |
| Molecular Formula | C20H31ClN2O4S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-chloro-N-(8-hydroxyoctyl)-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
| SMILES | O=C1NCCCC[C@H]1N(CCCCCCCCO)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H31ClN2O4S/c21-17-10-12-18(13-11-17)28(26,27)23(15-7-3-1-2-4-8-16-24)19-9-5-6-14-22-20(19)25/h10-13,19,24H,1-9,14-16H2,(H,22,25)/t19-/m1/s1 |
| InChIKey | YVWALDGFNSCJQP-LJQANCHMSA-N |
| XLogP | 3.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|