C9H7N4O5- — CID 6947143
1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylate (PubChem CID 6947143) has the molecular formula C9H7N4O5- and a molecular weight of 251.18 g/mol. Its IUPAC name is 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylate.
| Compound Name | 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylate |
|---|---|
| PubChem CID | 6947143 |
| Molecular Formula | C9H7N4O5- |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylate |
| SMILES | Cn1c(=O)c2nc(C(=O)[O-])c(=O)[nH]c2n(C)c1=O |
| InChI | InChI=1S/C9H8N4O5/c1-12-5-3(7(15)13(2)9(12)18)10-4(8(16)17)6(14)11-5/h1-2H3,(H,11,14)(H,16,17)/p-1 |
| InChIKey | HXXQJEUEICLLLJ-UHFFFAOYSA-M |
| XLogP | -3.32 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |