About methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate
methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate (PubChem CID 69471773) has the molecular formula C21H34N2O4
and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate |
| PubChem CID | 69471773 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate |
| SMILES | CCCCCCCn1c(C)c(C)cc(C(=O)N[C@H](C(=O)OC)C(C)C)c1=O |
| InChI | InChI=1S/C21H34N2O4/c1-7-8-9-10-11-12-23-16(5)15(4)13-17(20(23)25)19(24)22-18(14(2)3)21(26)27-6/h13-14,18H,7-12H2,1-6H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | HOIPEUFSRWQPML-SFHVURJKSA-N |
| XLogP | 3.36 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate?
The IUPAC name of methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate (CID 69471773) is methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate.
What is the SMILES notation for methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate?
The canonical SMILES for methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate is CCCCCCCn1c(C)c(C)cc(C(=O)N[C@H](C(=O)OC)C(C)C)c1=O.
What is the InChIKey of methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate?
The InChIKey is HOIPEUFSRWQPML-SFHVURJKSA-N. The full InChI is InChI=1S/C21H34N2O4/c1-7-8-9-10-11-12-23-16(5)15(4)13-17(20(23)25)19(24)22-18(14(2)3)21(26)27-6/h13-14,18H,7-12H2,1-6H3,(H,22,24)/t18-/m0/s1.
What are the key properties of methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate?
methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate has a molecular weight of 378.51 g/mol, XLogP of 3.36, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(1-heptyl-5,6-dimethyl-2-oxopyridine-3-carbonyl)amino]-3-methylbutanoate is sourced from PubChem (CID 69471773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).