About trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane
trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane (PubChem CID 69472098) has the molecular formula C12H13NSSi
and a molecular weight of 231.40 g/mol. Its IUPAC name is trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane.
Molecular Properties
| Compound Name | trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane |
| PubChem CID | 69472098 |
| Molecular Formula | C12H13NSSi |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane |
| SMILES | C[Si](C)(C)C#Cc1cc2cccnc2s1 |
| InChI | InChI=1S/C12H13NSSi/c1-15(2,3)8-6-11-9-10-5-4-7-13-12(10)14-11/h4-5,7,9H,1-3H3 |
| InChIKey | OMVMXMLKIZOVDR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane?
The IUPAC name of trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane (CID 69472098) is trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane.
What is the SMILES notation for trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane?
The canonical SMILES for trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane is C[Si](C)(C)C#Cc1cc2cccnc2s1.
What is the InChIKey of trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane?
The InChIKey is OMVMXMLKIZOVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NSSi/c1-15(2,3)8-6-11-9-10-5-4-7-13-12(10)14-11/h4-5,7,9H,1-3H3.
What are the key properties of trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane?
trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane has a molecular weight of 231.40 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(2-thieno[2,3-b]pyridin-2-ylethynyl)silane is sourced from PubChem (CID 69472098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).