C17H19ClN4+2 — CID 6947270
1-(benzylamino)-3-chloro-7-methyl-5,6,7,8-tetrahydro-2,7-naphthyridine-2,7-diium-4-carbonitrile (PubChem CID 6947270) has the molecular formula C17H19ClN4+2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 1-(benzylamino)-3-chloro-7-methyl-5,6,7,8-tetrahydro-2,7-naphthyridine-2,7-diium-4-carbonitrile.
| Compound Name | 1-(benzylamino)-3-chloro-7-methyl-5,6,7,8-tetrahydro-2,7-naphthyridine-2,7-diium-4-carbonitrile |
|---|---|
| PubChem CID | 6947270 |
| Molecular Formula | C17H19ClN4+2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(benzylamino)-3-chloro-7-methyl-5,6,7,8-tetrahydro-2,7-naphthyridine-2,7-diium-4-carbonitrile |
| SMILES | C[NH+]1CCc2c(C#N)c(Cl)[nH+]c(NCc3ccccc3)c2C1 |
| InChI | InChI=1S/C17H17ClN4/c1-22-8-7-13-14(9-19)16(18)21-17(15(13)11-22)20-10-12-5-3-2-4-6-12/h2-6H,7-8,10-11H2,1H3,(H,20,21)/p+2 |
| InChIKey | IXRIAJCAPAOBAY-UHFFFAOYSA-P |
| XLogP | 1.21 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|